![[ICO]](/icons/blank.gif){kind=icon}
![[DIR]](/icons/back.gif){kind=icon}
![[TXT]](/icons/text.gif){kind=icon}
![[ ]](powerpoint.png)
![[DIR]](/icons/folder.gif){kind=icon}
![[IMG]](/icons/image2.gif){kind=icon}
| Name | Last modified | Size | Description |
|---|---|---|---|---|
| Parent Directory | - | ||
| README.html | 23-Nov-2009 08:33 | 703 | |
| c01-intro-pt1.ppt | 10-Nov-2009 08:55 | 157K | (9/10) |
| c01-intro-pt2.ppt | 10-Nov-2009 08:55 | 171K | (9/10) |
| c02-tvm.ppt | 10-Nov-2009 08:55 | 767K | (9/15) |
| c03-perpetuities.ppt | 10-Nov-2009 08:55 | 590K | (9/17+9/22) |
| c04-capbudgrules.ppt | 10-Nov-2009 08:55 | 861K | (9/22+9/24) |
| c05-timevarying.ppt | 10-Nov-2009 08:55 | 874K | (9/24+9/29) |
| c06-uncertainty.ppt | 10-Nov-2009 08:55 | 1.2M | (10/01+10/06) |
| c07-invmotive.ppt | 10-Nov-2009 08:55 | 1.6M | (10/06+10/08) |
| c08-investchoices.ppt | 10-Nov-2009 08:55 | 1.2M | (10/08+10/13) |
| c09-capm.ppt | 10-Nov-2009 08:55 | 1.7M | (10/15+10/20) |
| c10-imperfect.ppt | 10-Nov-2009 08:55 | 645K | (10/27) PS: 10/22=midterm |
| c11-effmkts.ppt | 10-Nov-2009 08:55 | 610K | (10/29) |
| c12-npvadvice.ppt | 10-Nov-2009 09:59 | 802K | (11/03+11/05) |
| c13-financials.ppt | 10-Nov-2009 08:55 | 1.4M | (11/10) |
| c14-comparables.ppt | 10-Nov-2009 08:55 | 613K | (11/12) [needs final edit] |
| c15-corpclaims.ppt | 10-Nov-2009 08:55 | 279K | (11/17) |
| c16-capideal.ppt | 18-Nov-2009 05:51 | 236K | (11/17) |
| c17-capctaxes.ppt | 19-Nov-2009 17:04 | 612K | (11/19) |
| c18-caprest.ppt | 19-Nov-2009 06:23 | 569K | Plan: 12/01 |
| c19-payout.ppt | 19-Nov-2009 06:23 | 369K | Plan: 12/03 |
| exams/ | 10-Nov-2009 08:56 | - | |
| pdf/ | 10-Nov-2009 09:59 | - | probably outdated -- use ppt files instead |
| powerpoint.png | 14-Oct-2009 08:23 | 2.1K | pretty icon |
These slides can be freely downloaded and distributed. There are no copyright restrictions.
Note that Brown U does not coordinate its investments and corporate finance courses as a sequence. Thus, the first half of this course has a lot of necessary "investments" related material in it (e.g., how to compound rates of returns, net present values, the role of uncertainty, default vs. risk compensation, basic contingent claims, diversification, the CAPM, and efficient markets). This material needs to be fully understood by students before much of "corporate finance proper" can be covered. Therefore, this course pushes the limits in terms of what it can cram into one semester.